C10H11ClS — CID 150447930
2,4,5-trimethylbenzenecarbothioyl chloride (PubChem CID 150447930) has the molecular formula C10H11ClS and a molecular weight of 198.72 g/mol. Its IUPAC name is 2,4,5-trimethylbenzenecarbothioyl chloride.
| Compound Name | 2,4,5-trimethylbenzenecarbothioyl chloride |
|---|---|
| PubChem CID | 150447930 |
| Molecular Formula | C10H11ClS |
| Molecular Weight | 198.72 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2,4,5-trimethylbenzenecarbothioyl chloride |
| SMILES | Cc1cc(C)c(C(=S)Cl)cc1C |
| InChI | InChI=1S/C10H11ClS/c1-6-4-8(3)9(10(11)12)5-7(6)2/h4-5H,1-3H3 |
| InChIKey | HNECWDLPSYTJSH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|