C17H16ClNO3 — CID 2589575
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2589575) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2589575 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 6-chloropyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2ccc(Cl)nc2)cc1C |
| InChI | InChI=1S/C17H16ClNO3/c1-10-6-12(3)14(7-11(10)2)15(20)9-22-17(21)13-4-5-16(18)19-8-13/h4-8H,9H2,1-3H3 |
| InChIKey | LYINXYOLTCOETC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|