C20H18N2O3 — CID 7676596
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] quinoxaline-6-carboxylate (PubChem CID 7676596) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] quinoxaline-6-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 7676596 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] quinoxaline-6-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2ccc3nccnc3c2)cc1C |
| InChI | InChI=1S/C20H18N2O3/c1-12-8-14(3)16(9-13(12)2)19(23)11-25-20(24)15-4-5-17-18(10-15)22-7-6-21-17/h4-10H,11H2,1-3H3 |
| InChIKey | FSQLJJGZEYPGQK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |