C19H20O4 — CID 16522195
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methoxybenzoate (PubChem CID 16522195) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methoxybenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 16522195 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)c2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C19H20O4/c1-12-8-14(3)17(9-13(12)2)18(20)11-23-19(21)15-6-5-7-16(10-15)22-4/h5-10H,11H2,1-4H3 |
| InChIKey | JCFMDLZLORAJSL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |