C17H15Cl2NO3 — CID 8021517
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021517) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021517 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2cnc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C17H15Cl2NO3/c1-9-4-11(3)13(5-10(9)2)15(21)8-23-17(22)12-6-14(18)16(19)20-7-12/h4-7H,8H2,1-3H3 |
| InChIKey | PEFUTFCMILBPMR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|