C10H9Cl2NO2 — CID 55473163
[(E)-but-2-enyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 55473163) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is [(E)-but-2-enyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [(E)-but-2-enyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 55473163 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | [(E)-but-2-enyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | C/C=C/COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NO2/c1-2-3-4-15-10(14)7-5-8(11)9(12)13-6-7/h2-3,5-6H,4H2,1H3/b3-2+ |
| InChIKey | JFAJSNYFQFAXLO-NSCUHMNNSA-N |
| XLogP | 3.12 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|