C12H15Cl2NO3 — CID 112686977
2-[(2-methylpropan-2-yl)oxy]ethyl 5,6-dichloropyridine-3-carboxylate (PubChem CID 112686977) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]ethyl 5,6-dichloropyridine-3-carboxylate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 112686977 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 5,6-dichloropyridine-3-carboxylate |
| SMILES | CC(C)(C)OCCOC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO3/c1-12(2,3)18-5-4-17-11(16)8-6-9(13)10(14)15-7-8/h6-7H,4-5H2,1-3H3 |
| InChIKey | TVTIQOBZJSNDRF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|