2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate

C14H10BrCl2NO3 — CID 55314897

IUPAC2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate
SMILESO=C(OCCOc1cccc(Br)c1)c1cnc(Cl)c(Cl)c1
InChIInChI=1S/C14H10BrCl2NO3/c15-10-2-1-3-11(7-10)20-4-5-21-14(19)9-6-12(16)13(17)18-8-9/h1-3,6-8H,4-5H2
InChIKeyFJWZHEMMPIICOG-UHFFFAOYSA-N
MW391.05 g/mol
LogP4.39
Rot. Bonds5

About 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate

2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate (PubChem CID 55314897) has the molecular formula C14H10BrCl2NO3 and a molecular weight of 391.05 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate.

Molecular Properties

Compound Name2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate
PubChem CID55314897
Molecular FormulaC14H10BrCl2NO3
Molecular Weight391.05 g/mol
Exact Mass388.92
IUPAC Name2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate
SMILESO=C(OCCOc1cccc(Br)c1)c1cnc(Cl)c(Cl)c1
InChIInChI=1S/C14H10BrCl2NO3/c15-10-2-1-3-11(7-10)20-4-5-21-14(19)9-6-12(16)13(17)18-8-9/h1-3,6-8H,4-5H2
InChIKeyFJWZHEMMPIICOG-UHFFFAOYSA-N
XLogP4.39
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500391.05
LogP ≤ 54.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate?
The IUPAC name of 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate (CID 55314897) is 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate.
What is the SMILES notation for 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate?
The canonical SMILES for 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate is O=C(OCCOc1cccc(Br)c1)c1cnc(Cl)c(Cl)c1.
What is the InChIKey of 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate?
The InChIKey is FJWZHEMMPIICOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrCl2NO3/c15-10-2-1-3-11(7-10)20-4-5-21-14(19)9-6-12(16)13(17)18-8-9/h1-3,6-8H,4-5H2.
What are the key properties of 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate?
2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate has a molecular weight of 391.05 g/mol, XLogP of 4.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate is sourced from PubChem (CID 55314897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).