C14H10BrCl2NO3 — CID 55314897
2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate (PubChem CID 55314897) has the molecular formula C14H10BrCl2NO3 and a molecular weight of 391.05 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate.
| Compound Name | 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 55314897 |
| Molecular Formula | C14H10BrCl2NO3 |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(OCCOc1cccc(Br)c1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrCl2NO3/c15-10-2-1-3-11(7-10)20-4-5-21-14(19)9-6-12(16)13(17)18-8-9/h1-3,6-8H,4-5H2 |
| InChIKey | FJWZHEMMPIICOG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|