C14H10BrCl3N2O3 — CID 16577213
2-(3-bromophenoxy)ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 16577213) has the molecular formula C14H10BrCl3N2O3 and a molecular weight of 440.51 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | 2-(3-bromophenoxy)ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 16577213 |
| Molecular Formula | C14H10BrCl3N2O3 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 437.89 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)OCCOc2cccc(Br)c2)c1Cl |
| InChI | InChI=1S/C14H10BrCl3N2O3/c15-7-2-1-3-8(6-7)22-4-5-23-14(21)12-9(16)11(19)10(17)13(18)20-12/h1-3,6H,4-5H2,(H2,19,20) |
| InChIKey | JKYSSMWRPWWGKZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|