C14H12Cl2N4O5 — CID 2508533
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 2508533) has the molecular formula C14H12Cl2N4O5 and a molecular weight of 387.18 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2508533 |
| Molecular Formula | C14H12Cl2N4O5 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)c2cnc(Cl)c(Cl)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H12Cl2N4O5/c1-19-11(17)9(12(22)20(2)14(19)24)8(21)5-25-13(23)6-3-7(15)10(16)18-4-6/h3-4H,5,17H2,1-2H3 |
| InChIKey | NGQRWWQHMCKDMP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|