C16H16Cl2N4O5 — CID 8021721
[2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021721) has the molecular formula C16H16Cl2N4O5 and a molecular weight of 415.23 g/mol. Its IUPAC name is [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021721 |
| Molecular Formula | C16H16Cl2N4O5 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | CCCn1c(N)c(C(=O)COC(=O)c2cnc(Cl)c(Cl)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H16Cl2N4O5/c1-3-4-22-13(19)11(14(24)21(2)16(22)26)10(23)7-27-15(25)8-5-9(17)12(18)20-6-8/h5-6H,3-4,7,19H2,1-2H3 |
| InChIKey | MNNNOMIUJVYANP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|