C16H17ClN4O5 — CID 7867659
[2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 7867659) has the molecular formula C16H17ClN4O5 and a molecular weight of 380.79 g/mol. Its IUPAC name is [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7867659 |
| Molecular Formula | C16H17ClN4O5 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [2-(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | CCCn1c(N)c(C(=O)COC(=O)c2cccnc2Cl)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H17ClN4O5/c1-3-7-21-13(18)11(14(23)20(2)16(21)25)10(22)8-26-15(24)9-5-4-6-19-12(9)17/h4-6H,3,7-8,18H2,1-2H3 |
| InChIKey | PYUSSUIBBNLTSM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|