C14H12Cl3N3O4 — CID 2571125
6-amino-1,3-dimethyl-5-[2-(2,4,5-trichlorophenoxy)acetyl]pyrimidine-2,4-dione (PubChem CID 2571125) has the molecular formula C14H12Cl3N3O4 and a molecular weight of 392.63 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[2-(2,4,5-trichlorophenoxy)acetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-[2-(2,4,5-trichlorophenoxy)acetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2571125 |
| Molecular Formula | C14H12Cl3N3O4 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[2-(2,4,5-trichlorophenoxy)acetyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(C(=O)COc2cc(Cl)c(Cl)cc2Cl)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H12Cl3N3O4/c1-19-12(18)11(13(22)20(2)14(19)23)9(21)5-24-10-4-7(16)6(15)3-8(10)17/h3-4H,5,18H2,1-2H3 |
| InChIKey | PMVGHFFUVJSTBI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|