C16H11Cl2NO5 — CID 4573502
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 4573502) has the molecular formula C16H11Cl2NO5 and a molecular weight of 368.17 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 4573502 |
| Molecular Formula | C16H11Cl2NO5 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cnc(Cl)c(Cl)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H11Cl2NO5/c17-11-5-10(7-19-15(11)18)16(21)24-8-12(20)9-1-2-13-14(6-9)23-4-3-22-13/h1-2,5-7H,3-4,8H2 |
| InChIKey | LFKMYGKQCVAZBH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|