C17H12ClNO7 — CID 7813359
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 7813359) has the molecular formula C17H12ClNO7 and a molecular weight of 377.74 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 7813359 |
| Molecular Formula | C17H12ClNO7 |
| Molecular Weight | 377.74 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H12ClNO7/c18-13-3-2-11(19(22)23)8-12(13)17(21)26-9-14(20)10-1-4-15-16(7-10)25-6-5-24-15/h1-4,7-8H,5-6,9H2 |
| InChIKey | ZAVSFPNBPLZHSD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|