C18H14ClNO7 — CID 9202836
[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate (PubChem CID 9202836) has the molecular formula C18H14ClNO7 and a molecular weight of 391.76 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 9202836 |
| Molecular Formula | C18H14ClNO7 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H14ClNO7/c19-14-9-12(20(23)24)3-4-13(14)18(22)27-10-15(21)11-2-5-16-17(8-11)26-7-1-6-25-16/h2-5,8-9H,1,6-7,10H2 |
| InChIKey | AIBTVCLNDFCVKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|