C18H19ClN2O5S — CID 8017395
[2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 8017395) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is [2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8017395 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(Cl)nc2)c(C)n1[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H19ClN2O5S/c1-11-7-15(12(2)21(11)14-5-6-27(24,25)10-14)16(22)9-26-18(23)13-3-4-17(19)20-8-13/h3-4,7-8,14H,5-6,9-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | YEPXHRSTDARIEO-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|