C20H21NO6S — CID 7966393
[2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-formylbenzoate (PubChem CID 7966393) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is [2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 7966393 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-formylbenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(C=O)cc2)c(C)n1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H21NO6S/c1-13-9-18(14(2)21(13)17-7-8-28(25,26)12-17)19(23)11-27-20(24)16-5-3-15(10-22)4-6-16/h3-6,9-10,17H,7-8,11-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | PAHGLBXFZSYTDI-QGZVFWFLSA-N |
| XLogP | 2.32 |
| TPSA | 99.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|