C21H25NO6S — CID 8009561
4-[2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-3-ethoxybenzaldehyde (PubChem CID 8009561) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-3-ethoxybenzaldehyde.
| Compound Name | 4-[2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-3-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 8009561 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-[2-[1-[(3S)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-3-ethoxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OCC(=O)c1cc(C)n([C@H]2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C21H25NO6S/c1-4-27-21-10-16(11-23)5-6-20(21)28-12-19(24)18-9-14(2)22(15(18)3)17-7-8-29(25,26)13-17/h5-6,9-11,17H,4,7-8,12-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | ZYQCBRDHKSNQCZ-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|