C10H10ClN3O4 — CID 2628770
[2-(methylcarbamoylamino)-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2628770) has the molecular formula C10H10ClN3O4 and a molecular weight of 271.66 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2628770 |
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H10ClN3O4/c1-12-10(17)14-8(15)5-18-9(16)6-2-3-7(11)13-4-6/h2-4H,5H2,1H3,(H2,12,14,15,17) |
| InChIKey | RORSRAUHZLKWDD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|