C12H14ClN3O4 — CID 2589684
[2-oxo-2-(propylcarbamoylamino)ethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2589684) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2589684 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H14ClN3O4/c1-2-5-14-12(19)16-10(17)7-20-11(18)8-3-4-9(13)15-6-8/h3-4,6H,2,5,7H2,1H3,(H2,14,16,17,19) |
| InChIKey | HEPAUONOQQNPJO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|