C14H19ClO — CID 146008095
3-chloro-2,2-dimethyl-1-(2,4,5-trimethylphenyl)propan-1-one (PubChem CID 146008095) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-(2,4,5-trimethylphenyl)propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-(2,4,5-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 146008095 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-(2,4,5-trimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C(=O)C(C)(C)CCl)cc1C |
| InChI | InChI=1S/C14H19ClO/c1-9-6-11(3)12(7-10(9)2)13(16)14(4,5)8-15/h6-7H,8H2,1-5H3 |
| InChIKey | VOSFSSYQPTVGFY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|