C12H13ClF2O2 — CID 146006147
3-chloro-1-(4,5-difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one (PubChem CID 146006147) has the molecular formula C12H13ClF2O2 and a molecular weight of 262.68 g/mol. Its IUPAC name is 3-chloro-1-(4,5-difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(4,5-difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 146006147 |
| Molecular Formula | C12H13ClF2O2 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-chloro-1-(4,5-difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one |
| SMILES | COc1cc(F)c(F)cc1C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H13ClF2O2/c1-12(2,6-13)11(16)7-4-8(14)9(15)5-10(7)17-3/h4-5H,6H2,1-3H3 |
| InChIKey | FXTRESCQPYGHEK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|