C12H14ClFO2 — CID 146008428
3-chloro-1-(3-fluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one (PubChem CID 146008428) has the molecular formula C12H14ClFO2 and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-chloro-1-(3-fluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(3-fluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 146008428 |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-chloro-1-(3-fluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-one |
| SMILES | COc1c(F)cccc1C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H14ClFO2/c1-12(2,7-13)11(15)8-5-4-6-9(14)10(8)16-3/h4-6H,7H2,1-3H3 |
| InChIKey | KPPZZIQQLNMYRM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|