C15H16F4O4 — CID 141205273
4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-5-methyl-2-(trifluoromethyl)hex-4-enoic acid (PubChem CID 141205273) has the molecular formula C15H16F4O4 and a molecular weight of 336.28 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-5-methyl-2-(trifluoromethyl)hex-4-enoic acid.
| Compound Name | 4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-5-methyl-2-(trifluoromethyl)hex-4-enoic acid |
|---|---|
| PubChem CID | 141205273 |
| Molecular Formula | C15H16F4O4 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-(3-fluoro-2-methoxyphenyl)-2-hydroxy-5-methyl-2-(trifluoromethyl)hex-4-enoic acid |
| SMILES | COc1c(F)cccc1C(CC(O)(C(=O)O)C(F)(F)F)=C(C)C |
| InChI | InChI=1S/C15H16F4O4/c1-8(2)10(7-14(22,13(20)21)15(17,18)19)9-5-4-6-11(16)12(9)23-3/h4-6,22H,7H2,1-3H3,(H,20,21) |
| InChIKey | ZEABGBFZHVOLLZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |