C16H15F2NO — CID 102707053
(5-amino-2,4-dimethylphenyl)-(2,4-difluoro-5-methylphenyl)methanone (PubChem CID 102707053) has the molecular formula C16H15F2NO and a molecular weight of 275.30 g/mol. Its IUPAC name is (5-amino-2,4-dimethylphenyl)-(2,4-difluoro-5-methylphenyl)methanone.
| Compound Name | (5-amino-2,4-dimethylphenyl)-(2,4-difluoro-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 102707053 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (5-amino-2,4-dimethylphenyl)-(2,4-difluoro-5-methylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2cc(C)c(F)cc2F)cc1N |
| InChI | InChI=1S/C16H15F2NO/c1-8-4-10(3)15(19)6-11(8)16(20)12-5-9(2)13(17)7-14(12)18/h4-7H,19H2,1-3H3 |
| InChIKey | XJIZIONRVPKZKY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|