C13H6BrClF3NO — CID 105400298
(5-amino-2,4-difluorophenyl)-(4-bromo-5-chloro-2-fluorophenyl)methanone (PubChem CID 105400298) has the molecular formula C13H6BrClF3NO and a molecular weight of 364.55 g/mol. Its IUPAC name is (5-amino-2,4-difluorophenyl)-(4-bromo-5-chloro-2-fluorophenyl)methanone.
| Compound Name | (5-amino-2,4-difluorophenyl)-(4-bromo-5-chloro-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 105400298 |
| Molecular Formula | C13H6BrClF3NO |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | (5-amino-2,4-difluorophenyl)-(4-bromo-5-chloro-2-fluorophenyl)methanone |
| SMILES | Nc1cc(C(=O)c2cc(Cl)c(Br)cc2F)c(F)cc1F |
| InChI | InChI=1S/C13H6BrClF3NO/c14-7-3-9(16)5(1-8(7)15)13(20)6-2-12(19)11(18)4-10(6)17/h1-4H,19H2 |
| InChIKey | WESDLZKCISIHRQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|