C13H5BrCl4FNO — CID 105350302
(5-amino-2-bromo-4-fluorophenyl)-(2,3,4,6-tetrachlorophenyl)methanone (PubChem CID 105350302) has the molecular formula C13H5BrCl4FNO and a molecular weight of 431.90 g/mol. Its IUPAC name is (5-amino-2-bromo-4-fluorophenyl)-(2,3,4,6-tetrachlorophenyl)methanone.
| Compound Name | (5-amino-2-bromo-4-fluorophenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
|---|---|
| PubChem CID | 105350302 |
| Molecular Formula | C13H5BrCl4FNO |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 428.83 |
| IUPAC Name | (5-amino-2-bromo-4-fluorophenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
| SMILES | Nc1cc(C(=O)c2c(Cl)cc(Cl)c(Cl)c2Cl)c(Br)cc1F |
| InChI | InChI=1S/C13H5BrCl4FNO/c14-5-2-8(19)9(20)1-4(5)13(21)10-6(15)3-7(16)11(17)12(10)18/h1-3H,20H2 |
| InChIKey | KXTKCTAGVYYUQB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|