C14H7BrCl4O — CID 105349193
(2-bromo-4-methylphenyl)-(2,3,4,6-tetrachlorophenyl)methanone (PubChem CID 105349193) has the molecular formula C14H7BrCl4O and a molecular weight of 412.93 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl)-(2,3,4,6-tetrachlorophenyl)methanone.
| Compound Name | (2-bromo-4-methylphenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
|---|---|
| PubChem CID | 105349193 |
| Molecular Formula | C14H7BrCl4O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 409.84 |
| IUPAC Name | (2-bromo-4-methylphenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2c(Cl)cc(Cl)c(Cl)c2Cl)c(Br)c1 |
| InChI | InChI=1S/C14H7BrCl4O/c1-6-2-3-7(8(15)4-6)14(20)11-9(16)5-10(17)12(18)13(11)19/h2-5H,1H3 |
| InChIKey | KEUPQDPJTSRXFU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|