C14H9Cl4NO2 — CID 105350296
(4-amino-2-methoxyphenyl)-(2,3,4,6-tetrachlorophenyl)methanone (PubChem CID 105350296) has the molecular formula C14H9Cl4NO2 and a molecular weight of 365.04 g/mol. Its IUPAC name is (4-amino-2-methoxyphenyl)-(2,3,4,6-tetrachlorophenyl)methanone.
| Compound Name | (4-amino-2-methoxyphenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
|---|---|
| PubChem CID | 105350296 |
| Molecular Formula | C14H9Cl4NO2 |
| Molecular Weight | 365.04 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | (4-amino-2-methoxyphenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
| SMILES | COc1cc(N)ccc1C(=O)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H9Cl4NO2/c1-21-10-4-6(19)2-3-7(10)14(20)11-8(15)5-9(16)12(17)13(11)18/h2-5H,19H2,1H3 |
| InChIKey | YYQQFQDSDWTFHQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.04 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|