C13H3Cl4F3O — CID 105349314
(2,3,4,6-tetrachlorophenyl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 105349314) has the molecular formula C13H3Cl4F3O and a molecular weight of 373.97 g/mol. Its IUPAC name is (2,3,4,6-tetrachlorophenyl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (2,3,4,6-tetrachlorophenyl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 105349314 |
| Molecular Formula | C13H3Cl4F3O |
| Molecular Weight | 373.97 g/mol |
| Exact Mass | 371.89 |
| IUPAC Name | (2,3,4,6-tetrachlorophenyl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H3Cl4F3O/c14-5-3-6(15)9(16)10(17)8(5)13(21)4-1-2-7(18)12(20)11(4)19/h1-3H |
| InChIKey | ZVDLAHGCBTUIIW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|