C14H6Cl4F2O — CID 105349322
2-(3,4-difluorophenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone (PubChem CID 105349322) has the molecular formula C14H6Cl4F2O and a molecular weight of 370.01 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone.
| Compound Name | 2-(3,4-difluorophenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone |
|---|---|
| PubChem CID | 105349322 |
| Molecular Formula | C14H6Cl4F2O |
| Molecular Weight | 370.01 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)c(F)c1)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H6Cl4F2O/c15-7-5-8(16)13(17)14(18)12(7)11(21)4-6-1-2-9(19)10(20)3-6/h1-3,5H,4H2 |
| InChIKey | MAGDCELVOOOZCJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|