C23H34N2O — CID 144506946
1-(2-amino-3,5-dimethylphenyl)ethanone;2,4-dimethyl-6-prop-1-en-2-ylaniline;ethane (PubChem CID 144506946) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-(2-amino-3,5-dimethylphenyl)ethanone;2,4-dimethyl-6-prop-1-en-2-ylaniline;ethane.
| Compound Name | 1-(2-amino-3,5-dimethylphenyl)ethanone;2,4-dimethyl-6-prop-1-en-2-ylaniline;ethane |
|---|---|
| PubChem CID | 144506946 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 1-(2-amino-3,5-dimethylphenyl)ethanone;2,4-dimethyl-6-prop-1-en-2-ylaniline;ethane |
| SMILES | C=C(C)c1cc(C)cc(C)c1N.CC.CC(=O)c1cc(C)cc(C)c1N |
| InChI | InChI=1S/C11H15N.C10H13NO.C2H6/c1-7(2)10-6-8(3)5-9(4)11(10)12;1-6-4-7(2)10(11)9(5-6)8(3)12;1-2/h5-6H,1,12H2,2-4H3;4-5H,11H2,1-3H3;1-2H3 |
| InChIKey | LUXNXWNSRAZITA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|