C16H24 — CID 145154814
2-methylprop-1-ene;1,2,5-trimethyl-3-prop-1-en-2-ylbenzene (PubChem CID 145154814) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-methylprop-1-ene;1,2,5-trimethyl-3-prop-1-en-2-ylbenzene.
| Compound Name | 2-methylprop-1-ene;1,2,5-trimethyl-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 145154814 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-methylprop-1-ene;1,2,5-trimethyl-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)C.C=C(C)c1cc(C)cc(C)c1C |
| InChI | InChI=1S/C12H16.C4H8/c1-8(2)12-7-9(3)6-10(4)11(12)5;1-4(2)3/h6-7H,1H2,2-5H3;1H2,2-3H3 |
| InChIKey | QQUZFEPNKIDKKI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|