C22H30N2 — CID 144506951
2,4-dimethyl-6-penta-1,4-dien-2-ylaniline;2,4,6-trimethylaniline (PubChem CID 144506951) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 2,4-dimethyl-6-penta-1,4-dien-2-ylaniline;2,4,6-trimethylaniline.
| Compound Name | 2,4-dimethyl-6-penta-1,4-dien-2-ylaniline;2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 144506951 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2,4-dimethyl-6-penta-1,4-dien-2-ylaniline;2,4,6-trimethylaniline |
| SMILES | C=CCC(=C)c1cc(C)cc(C)c1N.Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C13H17N.C9H13N/c1-5-6-10(3)12-8-9(2)7-11(4)13(12)14;1-6-4-7(2)9(10)8(3)5-6/h5,7-8H,1,3,6,14H2,2,4H3;4-5H,10H2,1-3H3 |
| InChIKey | LBEHXKLKDMKRCK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|