About 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene
2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene (PubChem CID 177043566) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene |
| PubChem CID | 177043566 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC/C=C(\C)c1cc(N)c(C)cc1C |
| InChI | InChI=1S/C13H19N.C4H8/c1-5-6-9(2)12-8-13(14)11(4)7-10(12)3;1-4(2)3/h6-8H,5,14H2,1-4H3;1H2,2-3H3/b9-6+; |
| InChIKey | QIDVTPRVKROFOX-MLBSPLJJSA-N |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene?
The IUPAC name of 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene (CID 177043566) is 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene.
What is the SMILES notation for 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene?
The canonical SMILES for 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene is C=C(C)C.CC/C=C(\C)c1cc(N)c(C)cc1C.
What is the InChIKey of 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene?
The InChIKey is QIDVTPRVKROFOX-MLBSPLJJSA-N. The full InChI is InChI=1S/C13H19N.C4H8/c1-5-6-9(2)12-8-13(14)11(4)7-10(12)3;1-4(2)3/h6-8H,5,14H2,1-4H3;1H2,2-3H3/b9-6+;.
What are the key properties of 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene?
2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene has a molecular weight of 245.41 g/mol, XLogP of 5.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-[(E)-pent-2-en-2-yl]aniline;2-methylprop-1-ene is sourced from PubChem (CID 177043566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).