C14H20 — CID 102094486
1,3,5-trimethyl-2-[(Z)-pent-2-en-2-yl]benzene (PubChem CID 102094486) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[(Z)-pent-2-en-2-yl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[(Z)-pent-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 102094486 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1,3,5-trimethyl-2-[(Z)-pent-2-en-2-yl]benzene |
| SMILES | CC/C=C(/C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H20/c1-6-7-11(3)14-12(4)8-10(2)9-13(14)5/h7-9H,6H2,1-5H3/b11-7- |
| InChIKey | PEPPMQCKABRYGR-XFFZJAGNSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |