C15H21N3 — CID 143882547
(2Z,4E)-2-amino-5-(2,4,6-trimethylphenyl)hexa-2,4-dienimidamide (PubChem CID 143882547) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2Z,4E)-2-amino-5-(2,4,6-trimethylphenyl)hexa-2,4-dienimidamide.
| Compound Name | (2Z,4E)-2-amino-5-(2,4,6-trimethylphenyl)hexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 143882547 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (2Z,4E)-2-amino-5-(2,4,6-trimethylphenyl)hexa-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(N)=C/C=C(\C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H21N3/c1-9-7-11(3)14(12(4)8-9)10(2)5-6-13(16)15(17)18/h5-8H,16H2,1-4H3,(H3,17,18)/b10-5+,13-6- |
| InChIKey | ZBLWGPPUJJXJNX-NFDGLWNWSA-N |
| XLogP | 2.79 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|