C11H17ClN2O — CID 134110059
2-(2,4,6-trimethylphenoxy)ethanimidamide;hydrochloride (PubChem CID 134110059) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenoxy)ethanimidamide;hydrochloride.
| Compound Name | 2-(2,4,6-trimethylphenoxy)ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 134110059 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(2,4,6-trimethylphenoxy)ethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)COc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C11H16N2O.ClH/c1-7-4-8(2)11(9(3)5-7)14-6-10(12)13;/h4-5H,6H2,1-3H3,(H3,12,13);1H |
| InChIKey | NLBYYSIEZQTUDF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|