C10H13ClN2O — CID 24711245
2-(4-chloro-2,6-dimethylphenoxy)ethanimidamide (PubChem CID 24711245) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)ethanimidamide.
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)ethanimidamide |
|---|---|
| PubChem CID | 24711245 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)ethanimidamide |
| SMILES | [H]/N=C(\N)COc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C10H13ClN2O/c1-6-3-8(11)4-7(2)10(6)14-5-9(12)13/h3-4H,5H2,1-2H3,(H3,12,13) |
| InChIKey | POVQIRDKUDYCFP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|