C12H13ClO — CID 63656035
2-but-3-ynoxy-5-chloro-1,3-dimethylbenzene (PubChem CID 63656035) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 2-but-3-ynoxy-5-chloro-1,3-dimethylbenzene.
| Compound Name | 2-but-3-ynoxy-5-chloro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 63656035 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-but-3-ynoxy-5-chloro-1,3-dimethylbenzene |
| SMILES | C#CCCOc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C12H13ClO/c1-4-5-6-14-12-9(2)7-11(13)8-10(12)3/h1,7-8H,5-6H2,2-3H3 |
| InChIKey | UVGXQHYUXKXMNQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|