C14H19NO — CID 60877811
1-(4-but-3-ynoxy-3,5-dimethylphenyl)-N-methylmethanamine (PubChem CID 60877811) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(4-but-3-ynoxy-3,5-dimethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(4-but-3-ynoxy-3,5-dimethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 60877811 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(4-but-3-ynoxy-3,5-dimethylphenyl)-N-methylmethanamine |
| SMILES | C#CCCOc1c(C)cc(CNC)cc1C |
| InChI | InChI=1S/C14H19NO/c1-5-6-7-16-14-11(2)8-13(10-15-4)9-12(14)3/h1,8-9,15H,6-7,10H2,2-4H3 |
| InChIKey | MFHSYEYDILOQNP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|