C16H23NO — CID 55028257
N-[(4-but-3-ynoxy-3,5-dimethylphenyl)methyl]propan-2-amine (PubChem CID 55028257) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N-[(4-but-3-ynoxy-3,5-dimethylphenyl)methyl]propan-2-amine.
| Compound Name | N-[(4-but-3-ynoxy-3,5-dimethylphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 55028257 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-[(4-but-3-ynoxy-3,5-dimethylphenyl)methyl]propan-2-amine |
| SMILES | C#CCCOc1c(C)cc(CNC(C)C)cc1C |
| InChI | InChI=1S/C16H23NO/c1-6-7-8-18-16-13(4)9-15(10-14(16)5)11-17-12(2)3/h1,9-10,12,17H,7-8,11H2,2-5H3 |
| InChIKey | WJGNPQWVZPYEAX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|