C14H17N — CID 158523336
(2Z,4E)-5-(3,5-dimethylphenyl)hexa-2,4-dien-1-imine (PubChem CID 158523336) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (2Z,4E)-5-(3,5-dimethylphenyl)hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-(3,5-dimethylphenyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 158523336 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2Z,4E)-5-(3,5-dimethylphenyl)hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C=C(/C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H17N/c1-11-8-12(2)10-14(9-11)13(3)6-4-5-7-15/h4-10,15H,1-3H3/b5-4-,13-6+,15-7+ |
| InChIKey | FEYCRHNPWUUZKP-GVXRUICRSA-N |
| XLogP | 3.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|