C17H17N — CID 156683300
(2Z)-2-[(6E)-6-[1-(3-methylphenyl)ethylidene]cyclohexa-2,4-dien-1-ylidene]ethanimine (PubChem CID 156683300) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is (2Z)-2-[(6E)-6-[1-(3-methylphenyl)ethylidene]cyclohexa-2,4-dien-1-ylidene]ethanimine.
| Compound Name | (2Z)-2-[(6E)-6-[1-(3-methylphenyl)ethylidene]cyclohexa-2,4-dien-1-ylidene]ethanimine |
|---|---|
| PubChem CID | 156683300 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2Z)-2-[(6E)-6-[1-(3-methylphenyl)ethylidene]cyclohexa-2,4-dien-1-ylidene]ethanimine |
| SMILES | [H]/N=C/C=c1/cccc/c1=C(/C)c1cccc(C)c1 |
| InChI | InChI=1S/C17H17N/c1-13-6-5-8-16(12-13)14(2)17-9-4-3-7-15(17)10-11-18/h3-12,18H,1-2H3/b15-10-,17-14+,18-11+ |
| InChIKey | JOYHNVHLMWFXSA-ZGYONMQRSA-N |
| XLogP | 2.64 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|