C14H18 — CID 174069312
1-methyl-3-[(2E)-5-methylhexa-2,4-dien-2-yl]benzene (PubChem CID 174069312) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-methyl-3-[(2E)-5-methylhexa-2,4-dien-2-yl]benzene.
| Compound Name | 1-methyl-3-[(2E)-5-methylhexa-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 174069312 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-methyl-3-[(2E)-5-methylhexa-2,4-dien-2-yl]benzene |
| SMILES | CC(C)=C/C=C(\C)c1cccc(C)c1 |
| InChI | InChI=1S/C14H18/c1-11(2)8-9-13(4)14-7-5-6-12(3)10-14/h5-10H,1-4H3/b13-9+ |
| InChIKey | RAMOCBVDSMHMHX-UKTHLTGXSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|