C13H15N — CID 146293925
(2Z)-2-[(6E)-6-(1-cyclopropylethylidene)cyclohexa-2,4-dien-1-ylidene]ethanimine (PubChem CID 146293925) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (2Z)-2-[(6E)-6-(1-cyclopropylethylidene)cyclohexa-2,4-dien-1-ylidene]ethanimine.
| Compound Name | (2Z)-2-[(6E)-6-(1-cyclopropylethylidene)cyclohexa-2,4-dien-1-ylidene]ethanimine |
|---|---|
| PubChem CID | 146293925 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2Z)-2-[(6E)-6-(1-cyclopropylethylidene)cyclohexa-2,4-dien-1-ylidene]ethanimine |
| SMILES | [H]/N=C/C=c1/cccc/c1=C(/C)C1CC1 |
| InChI | InChI=1S/C13H15N/c1-10(11-6-7-11)13-5-3-2-4-12(13)8-9-14/h2-5,8-9,11,14H,6-7H2,1H3/b12-8-,13-10+,14-9+ |
| InChIKey | PBIIUCSJUJLQQT-QSBRNYSSSA-N |
| XLogP | 1.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|