C8H13N — CID 58352423
(2E)-3-propan-2-ylpenta-2,4-dien-1-imine (PubChem CID 58352423) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (2E)-3-propan-2-ylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-3-propan-2-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 58352423 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (2E)-3-propan-2-ylpenta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(/C=C)C(C)C |
| InChI | InChI=1S/C8H13N/c1-4-8(5-6-9)7(2)3/h4-7,9H,1H2,2-3H3/b8-5-,9-6+ |
| InChIKey | CAKZQKFZSKSGOB-LDFAFZTOSA-N |
| XLogP | 2.40 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|