About 4-methylpenta-2,4-dienylideneazanium
4-methylpenta-2,4-dienylideneazanium (PubChem CID 91576873) has the molecular formula C6H10N+
and a molecular weight of 96.15 g/mol. Its IUPAC name is 4-methylpenta-2,4-dienylideneazanium.
Molecular Properties
| Compound Name | 4-methylpenta-2,4-dienylideneazanium |
| PubChem CID | 91576873 |
| Molecular Formula | C6H10N+ |
| Molecular Weight | 96.15 g/mol |
| Exact Mass | 96.08 |
| IUPAC Name | 4-methylpenta-2,4-dienylideneazanium |
| SMILES | C=C(C)C=CC=[NH2+] |
| InChI | InChI=1S/C6H9N/c1-6(2)4-3-5-7/h3-5,7H,1H2,2H3/p+1 |
| InChIKey | GLQYGZMNMCEXTF-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpenta-2,4-dienylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpenta-2,4-dienylideneazanium?
The IUPAC name of 4-methylpenta-2,4-dienylideneazanium (CID 91576873) is 4-methylpenta-2,4-dienylideneazanium.
What is the SMILES notation for 4-methylpenta-2,4-dienylideneazanium?
The canonical SMILES for 4-methylpenta-2,4-dienylideneazanium is C=C(C)C=CC=[NH2+].
What is the InChIKey of 4-methylpenta-2,4-dienylideneazanium?
The InChIKey is GLQYGZMNMCEXTF-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H9N/c1-6(2)4-3-5-7/h3-5,7H,1H2,2H3/p+1.
What are the key properties of 4-methylpenta-2,4-dienylideneazanium?
4-methylpenta-2,4-dienylideneazanium has a molecular weight of 96.15 g/mol, XLogP of -0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpenta-2,4-dienylideneazanium is sourced from PubChem (CID 91576873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).