C6H10N+ — CID 91576873
4-methylpenta-2,4-dienylideneazanium (PubChem CID 91576873) has the molecular formula C6H10N+ and a molecular weight of 96.15 g/mol. Its IUPAC name is 4-methylpenta-2,4-dienylideneazanium.
| Compound Name | 4-methylpenta-2,4-dienylideneazanium |
|---|---|
| PubChem CID | 91576873 |
| Molecular Formula | C6H10N+ |
| Molecular Weight | 96.15 g/mol |
| Exact Mass | 96.08 |
| IUPAC Name | 4-methylpenta-2,4-dienylideneazanium |
| SMILES | C=C(C)C=CC=[NH2+] |
| InChI | InChI=1S/C6H9N/c1-6(2)4-3-5-7/h3-5,7H,1H2,2H3/p+1 |
| InChIKey | GLQYGZMNMCEXTF-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|