About (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride
(2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride (PubChem CID 138623915) has the molecular formula C9H14FN
and a molecular weight of 155.21 g/mol. Its IUPAC name is (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride.
Molecular Properties
| Compound Name | (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride |
| PubChem CID | 138623915 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.21 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride |
| SMILES | C/C=C(\C=C/C(=N)F)/C(C)C |
| InChI | InChI=1S/C9H14FN/c1-4-8(7(2)3)5-6-9(10)11/h4-7,11H,1-3H3/b6-5-,8-4+,11-9? |
| InChIKey | IQUFSIQHYWMHPS-ORRNJDHISA-N |
| XLogP | 3.20 |
| TPSA | 23.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 190 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride?
The IUPAC name of (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride (CID 138623915) is (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride.
What is the SMILES notation for (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride?
The canonical SMILES for (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride is C/C=C(\C=C/C(=N)F)/C(C)C.
What is the InChIKey of (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride?
The InChIKey is IQUFSIQHYWMHPS-ORRNJDHISA-N. The full InChI is InChI=1S/C9H14FN/c1-4-8(7(2)3)5-6-9(10)11/h4-7,11H,1-3H3/b6-5-,8-4+,11-9?.
What are the key properties of (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride?
(2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride has a molecular weight of 155.21 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride is sourced from PubChem (CID 138623915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).