C9H14FN — CID 138623915
(2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride (PubChem CID 138623915) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride.
| Compound Name | (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride |
|---|---|
| PubChem CID | 138623915 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2Z,4Z)-4-propan-2-ylhexa-2,4-dienimidoyl fluoride |
| SMILES | [H]/N=C(F)/C=C\C(=C/C)C(C)C |
| InChI | InChI=1S/C9H14FN/c1-4-8(7(2)3)5-6-9(10)11/h4-7,11H,1-3H3/b6-5-,8-4+,11-9- |
| InChIKey | IQUFSIQHYWMHPS-PCWYHWOHSA-N |
| XLogP | 3.09 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|